সাঁচ:Infobox mineral

{{PAGENAME}}
সাধাৰণ

সাঁচ নথিকৰণ

This template is used on pages about minerals as well as gemstones to provide handy easy to access data about that mineral.

Usage

Most field names are in lowercase.

Copy a blank version to use. Please delete any unused fields to avoid clutter in the edit window.

Ruby
A naturally occurring ruby crystal
সাধাৰণ
শ্ৰেণী	Mineral variety
সংকেত (repeating unit)	aluminium oxide with chromium, Al2O3:Cr
স্ফটিক প্ৰণালী	Trigonal
স্ফটিক শ্ৰেণী	Hexagonal scalenohedral (3m) H-M symbol: (3 2/m)
স্থান গোট	R3c (No. 167)
একক কোষ	unit cell
চিনাক্তকৰণ
Color	Red, may be brownish, purplish or pinkish
স্ফটিক স্বভাৱ	Varies with locality. Terminated tabular hexagonal prisms.
বিভাজন	No true cleavage
ভংগণ	Uneven or conchoidal
মহ‌্ছ স্কেল কঠিনতা	9.0
Luster	Vitreous
প্ৰৱণতা	white
Diaphaneity	transparent
Specific gravity	4.0
Refractive index	nω=1.768 - 1.772 nε=1.760 - 1.763, Birefringence 0.008
Pleochroism	Orangey red, purplish red
Ultraviolet fluorescence	red under longwave
Melting point	2044 °C
Solubility	none
Major varieties
Sapphire	Any color except red and violet
Oriental amethyst	violet color
Corundum	various colors (mineral species)
Emery	Granular (mineral mixture)

{{Infobox mineral
| name        = 
| boxwidth    = 
| boxbgcolor  = 
| image       = 
| imagesize   = 
| alt         = 
| caption     = 
| struct image     =
| struct caption   =
| struct imagesize =
| struct2 image    =
| struct2 caption  =
| struct2 imagesize=
| SMILES           =
| Jmol             =
| category    = 
| formula     = 
| molweight   = 
| strunz      = 
| dana        = 
| system      = 
| class       = 
| symmetry    = 
| unit cell   = 
| color       = 
| colour      = 
| habit       = 
| twinning    = 
| cleavage    = 
| fracture    = 
| tenacity    = 
| toughness   = 
| mohs        = 
| luster      = 
| streak      = 
| diaphaneity = 
| gravity     = 
| density     = 
| polish      = 
| opticalprop = 
| refractive  = 
| birefringence = 
| pleochroism = 
| 2V          = 
| dispersion  = 
| extinction  = 
| length fast/slow =
| fluorescence = 
| absorption  = 
| melt        = 
| Curie temp  = 
| fusibility  = 
| diagnostic  = 
| solubility  = 
| impurities  = 
| alteration  = 
| other       = 
| prop1       = 
| prop1text   = 
| references  = 
| var1        = 
| var1text    = 
| var2        = 
| var2text    = 
| var3        = 
| var3text    = 
| var4        = 
| var4text    = 
| var5        = 
| var5text    = 
| var6        = 
| var6text    = 
}}

All parameters used

name
caption
সাধাৰণ
শ্ৰেণী	category
সংকেত (repeating unit)	formula
ষ্ট্ৰাঞ্জ বৰ্গীকৰণ	strunz
ডানা বৰ্গীকৰণ	dana
স্ফটিক প্ৰণালী	system
স্ফটিক শ্ৰেণী	class
স্থান গোট	symmetry
একক কোষ	unit cell
গঠন
Crystal structure of α-tridymite
Some other image
Jmol (3D)	Interactive image
চিনাক্তকৰণ
আণৱিক ভৰ	molweight
বৰণ	colorcolour
স্ফটিক স্বভাৱ	habit
টুইনিং	twinning
বিভাজন	cleavage
ভংগণ	fracture
টেনাছিটি	tenacity
মহ‌্ছ স্কেল কঠিনতা	mohs
Lustre	luster
প্ৰৱণতা	streak
Diaphaneity	diaphaneity
Specific gravity	gravity
ঘনত্ব	density
Polish lustre	polish
Optical properties	opticalprop
Refractive index	refractive
Birefringence	birefringence
Pleochroism	pleochroism
2V angle	2V
Dispersion	dispersion
Extinction	extinction
Length fast/slow	length fast/slow
Ultraviolet fluorescence	fluorescence
Absorption spectra	absorption
Melting point	melt
Fusibility	fusibility
Diagnostic features	diagnostic
Solubility	solubility
Common impurities	impurities
Alters to	alteration
Other characteristics	other
prop1	prop1text
References	references
Major varieties
var1	var1text
var2	var2text
var3	var3text
var4	var4text
var5	var5text
var6	var6text

| image = Tridymite tabulars - Ochtendung, Eifel, Germany.jpg
| imagesize   = 260px

|struct image=a-tridymite.png
|struct caption=Crystal structure of α-tridymite
|struct imagesize=150px
|struct2 image=Diamond lattice.stl
|struct2 caption=Some other image
|struct2 imagesize=200px

|SMILES = O[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]3(C)CC4
|Jmol= C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O<!-- different so will show difgferent struct - to test -->
|boxbgcolor = yellow

| 2V = 2V
| absorption = absorption
| alt = alt
| alteration = alteration
| birefringence = birefringence
| boxtextcolor = boxtextcolor
| boxwidth = boxwidth
| caption = caption
| category = category
| class = class
| cleavage = cleavage
| color = color
| colour = colour
| dana = dana
| density = density
| diagnostic = diagnostic
| diaphaneity = diaphaneity
| dispersion = dispersion
| extinction = extinction
| fluorescence = fluorescence
| formula = formula
| fracture = fracture
| fusibility = fusibility
| gravity = gravity
| habit = habit
| impurities = impurities
| length fast/slow = length fast/slow
| luster = luster
| lustre = lustre
| melt = melt
| mohs = mohs
| molweight = molweight
| name = name
| opticalprop = opticalprop
| other = other
| pleochroism = pleochroism
| polish = polish
| polish lustre = polish lustre
| prop1 = prop1
| prop1text = prop1text
| references = references
| refractive = refractive
| solubility = solubility
| streak = streak
| strunz = strunz
| symmetry = symmetry
| system = system
| tenacity = tenacity
| twinning = twinning
| unit cell = unit cell
| var1 = var1
| var1text = var1text
| var2 = var2
| var2text = var2text
| var3 = var3
| var3text = var3text
| var4 = var4
| var4text = var4text
| var5 = var5
| var5text = var5text
| var6 = var6
| var6text = var6text

Description

This should describe the parameters used in this template.

Parameter	Explanation	Example
name	IMA mineral name (if there is another common name, put it in parentheses)	Baryte (Barite)
boxwidth
boxbgcolor	Background color of box headers
boxtextcolor	Text color of box headers
image	Wikimedia Commons image filename (to go at top)	Epidoto.jpeg
imagesize
alt	alt text for image, for visually impaired readers; see WP:ALT	Agglomeration of dark cylindrical crystals
caption	image caption	Epidote crystals
category	broad group then subgroup then sub-subgroup (if applicable) template does not auto-link	Sulfate minerals, Barite group
formula	chemical formula giving the elemental composition of a repeating unit of an alloy, a polymer, a crystal structure, a chain, or a network	BaSO4
strunz	Nickel-Strunz classification of the mineral (10 ed, MinDat)	9.BG.05
dana	Dana classification of the mineral	28.03.01.01
symmetry	Hermann–Mauguin notation of the mineral's symmetry element, labeled: Space group
unit cell	Unit cell dimensions and number (Z) of formula units per unit cell
molweight	molar mass of the chemical formula above
color	common colors of the mineral
colour	same as above, but for British pages
habit	common mineral habit
system	crystal system (cubic, etc.)
class	crystal class
twinning	common type of twinning
cleavage	type of cleavage
fracture	type of fracture (appearance of broken surface)	irregular
tenacity	tenacity (how the mineral can deform or break)	brittle
toughness	toughness (quantitative resistance to deformation or breakage)
mohs	hardness (scratchability) of mineral on Mohs hardness scale	3-3.5
luster	way the mineral reflects light, see luster
lustre	same as above, but for British pages
streak	see streak
diaphaneity	transparency of mineral
gravity	specific gravity
density	density at STP in g/cm3
polish	ability to take a polish
opticalprop
refractive	refractive index of mineral
birefringence	birefringence of a 30micron thin section
pleochroism	see pleochroism
2V	2V angle
dispersion	see dispersion
extinction	extinction angle, e.g. "parallel", or "inclined" and a quantitative angle. Irrelevant for minerals without an extinction angle (isotropic, opaque, or amorphous minerals).
length fast/slow	Sign of elongation: length fast or length slow
fluorescence	see fluorescence
absorption	see absorption
melt	melting point of mineral
Curie	Curie temperature of mineral
fusibility	fusibility of mineral
diagnostic	key way to recognize mineral
solubility	solubility of mineral in water at STP
impurities	common impurities
alteration	alteration products
other
prop1
prop1text
references	use the Wikipedia template:ref to cite	References supporting the properties to be added at that line using <ref>...</ref> tag notation. Individual items can be tagged separately if needed.
var1
var1text
var2
var2text
var3
var3text
var4
var4text
var5
var5text
var6
var6text

TemplateData

This is the TemplateData documentation for this template used by VisualEditor and other tools.

See the monthly error report for this template.

TemplateData for Infobox mineral

কোনো বিৱৰণ নাই।

সাঁচ পেৰামিটাৰ[সাঁচ-তথ্য পৰিচালনা কৰক]

পেৰামিটাৰ		বিৱৰণ	প্ৰকাৰ	স্থিতি
boxwidth	boxwidth	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
boxtextcolor	boxtextcolor	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
boxbgcolor	boxbgcolor	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
name	name	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
image	image	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
imagesize	imagesize	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
alt	alt	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
caption	caption	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
category	category	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
formula	formula	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
strunz	strunz	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
system	system	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
dana	dana	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
class	class	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
symmetry	symmetry	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
unit cell	unit cell	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
molweight	molweight	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
color	color	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
habit	habit	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
twinning	twinning	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
cleavage	cleavage	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
fracture	fracture	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
tenacity	tenacity	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
mohs	mohs	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
luster	luster	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
polish	polish	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
opticalprop	opticalprop	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
refractive	refractive	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
birefringence	birefringence	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
pleochroism	pleochroism	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
2V	2V	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
dispersion	dispersion	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
extinction	extinction	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
length fast/slow	length fast/slow	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
fluorescence	fluorescence	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
absorption	absorption	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
streak	streak	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
gravity	gravity	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
density	density	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
melt	melt	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
fusibility	fusibility	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
diagnostic	diagnostic	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
solubility	solubility	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
diaphaneity	diaphaneity	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
impurities	impurities	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
alteration	alteration	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
other	other	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
prop1text	prop1text	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
references	references	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
colour	colour	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
lustre	lustre	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
polish lustre	polish lustre	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
prop1	prop1	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
var1	var1	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
var1text	var1text	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
var2	var2	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
var2text	var2text	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
var3	var3	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
var3text	var3text	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
var4	var4	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
var4text	var4text	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
var5	var5	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
var5text	var5text	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
var6	var6	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
var6text	var6text	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
struct image	struct image	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
struct2 image	struct2 image	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
struct caption	struct caption	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
struct imagesize	struct imagesize	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
struct alt	struct alt	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
struct2 imagesize	struct2 imagesize	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
struct2 caption	struct2 caption	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
struct2 alt	struct2 alt	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
Jmol	Jmol	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক
SMILES	SMILES	কোনো বিৱৰণ নাই	অজ্ঞাত	ঐচ্ছিক

Tracking category

• Category:Pages using Infobox mineral with unknown parameters (0)